C28H31N5O3 — CID 169206874
3-[6-[4-(azepan-1-ylmethyl)-1-methylpyrrolo[2,3-b]pyridin-6-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169206874) has the molecular formula C28H31N5O3 and a molecular weight of 485.59 g/mol. Its IUPAC name is 3-[6-[4-(azepan-1-ylmethyl)-1-methylpyrrolo[2,3-b]pyridin-6-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-(azepan-1-ylmethyl)-1-methylpyrrolo[2,3-b]pyridin-6-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169206874 |
| Molecular Formula | C28H31N5O3 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | 3-[6-[4-(azepan-1-ylmethyl)-1-methylpyrrolo[2,3-b]pyridin-6-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | Cn1ccc2c(CN3CCCCCC3)cc(-c3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)nc21 |
| InChI | InChI=1S/C28H31N5O3/c1-31-13-10-21-20(16-32-11-4-2-3-5-12-32)15-23(29-26(21)31)18-6-7-22-19(14-18)17-33(28(22)36)24-8-9-25(34)30-27(24)35/h6-7,10,13-15,24H,2-5,8-9,11-12,16-17H2,1H3,(H,30,34,35) |
| InChIKey | RIAFQNGVODWPOH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|