C26H29N5O4S — CID 169206400
3-[5-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-1-methylpyrrolo[2,3-b]pyridin-6-yl]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione (PubChem CID 169206400) has the molecular formula C26H29N5O4S and a molecular weight of 507.62 g/mol. Its IUPAC name is 3-[5-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-1-methylpyrrolo[2,3-b]pyridin-6-yl]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-1-methylpyrrolo[2,3-b]pyridin-6-yl]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169206400 |
| Molecular Formula | C26H29N5O4S |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | 3-[5-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-1-methylpyrrolo[2,3-b]pyridin-6-yl]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
| SMILES | Cn1ccc2c(CN3CCS(=O)(=O)CC3)cc(-c3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4)nc21 |
| InChI | InChI=1S/C26H29N5O4S/c1-29-7-6-21-20(14-30-8-10-36(34,35)11-9-30)13-22(27-25(21)29)17-2-3-18-15-31(16-19(18)12-17)23-4-5-24(32)28-26(23)33/h2-3,6-7,12-13,23H,4-5,8-11,14-16H2,1H3,(H,28,32,33) |
| InChIKey | PSXYCNONXNGTMI-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 104.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|