C28H30N6O3 — CID 169206313
3-[6-[8-(dimethylamino)-4-(pyrrolidin-1-ylmethyl)-1,5-naphthyridin-2-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169206313) has the molecular formula C28H30N6O3 and a molecular weight of 498.59 g/mol. Its IUPAC name is 3-[6-[8-(dimethylamino)-4-(pyrrolidin-1-ylmethyl)-1,5-naphthyridin-2-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[8-(dimethylamino)-4-(pyrrolidin-1-ylmethyl)-1,5-naphthyridin-2-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169206313 |
| Molecular Formula | C28H30N6O3 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | 3-[6-[8-(dimethylamino)-4-(pyrrolidin-1-ylmethyl)-1,5-naphthyridin-2-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CN(C)c1ccnc2c(CN3CCCC3)cc(-c3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)nc12 |
| InChI | InChI=1S/C28H30N6O3/c1-32(2)22-9-10-29-25-19(15-33-11-3-4-12-33)14-21(30-26(22)25)17-5-6-20-18(13-17)16-34(28(20)37)23-7-8-24(35)31-27(23)36/h5-6,9-10,13-14,23H,3-4,7-8,11-12,15-16H2,1-2H3,(H,31,35,36) |
| InChIKey | PSVXVLXUPOQTTK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|