C12H11ClN2O4S — CID 169206614
methyl 6-chloro-1-(1,1-dioxothietan-3-yl)pyrrolo[2,3-b]pyridine-4-carboxylate (PubChem CID 169206614) has the molecular formula C12H11ClN2O4S and a molecular weight of 314.75 g/mol. Its IUPAC name is methyl 6-chloro-1-(1,1-dioxothietan-3-yl)pyrrolo[2,3-b]pyridine-4-carboxylate.
| Compound Name | methyl 6-chloro-1-(1,1-dioxothietan-3-yl)pyrrolo[2,3-b]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 169206614 |
| Molecular Formula | C12H11ClN2O4S |
| Molecular Weight | 314.75 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | methyl 6-chloro-1-(1,1-dioxothietan-3-yl)pyrrolo[2,3-b]pyridine-4-carboxylate |
| SMILES | COC(=O)c1cc(Cl)nc2c1ccn2C1CS(=O)(=O)C1 |
| InChI | InChI=1S/C12H11ClN2O4S/c1-19-12(16)9-4-10(13)14-11-8(9)2-3-15(11)7-5-20(17,18)6-7/h2-4,7H,5-6H2,1H3 |
| InChIKey | QCXYVFRACVQLAR-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.75 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|