C11H8ClN3O2 — CID 169206454
methyl 6-chloro-1-(cyanomethyl)pyrrolo[2,3-b]pyridine-4-carboxylate (PubChem CID 169206454) has the molecular formula C11H8ClN3O2 and a molecular weight of 249.66 g/mol. Its IUPAC name is methyl 6-chloro-1-(cyanomethyl)pyrrolo[2,3-b]pyridine-4-carboxylate.
| Compound Name | methyl 6-chloro-1-(cyanomethyl)pyrrolo[2,3-b]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 169206454 |
| Molecular Formula | C11H8ClN3O2 |
| Molecular Weight | 249.66 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | methyl 6-chloro-1-(cyanomethyl)pyrrolo[2,3-b]pyridine-4-carboxylate |
| SMILES | COC(=O)c1cc(Cl)nc2c1ccn2CC#N |
| InChI | InChI=1S/C11H8ClN3O2/c1-17-11(16)8-6-9(12)14-10-7(8)2-4-15(10)5-3-13/h2,4,6H,5H2,1H3 |
| InChIKey | XJRVCHVDPWHKTM-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.66 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|