3-(2,6-dichlorophenyl)oxane-4-carboxylic acid

C12H12Cl2O3 — CID 169208325

IUPAC3-(2,6-dichlorophenyl)oxane-4-carboxylic acid
SMILESO=C(O)C1CCOCC1c1c(Cl)cccc1Cl
InChIInChI=1S/C12H12Cl2O3/c13-9-2-1-3-10(14)11(9)8-6-17-5-4-7(8)12(15)16/h1-3,7-8H,4-6H2,(H,15,16)
InChIKeyKTJJJWQFGBAUPE-UHFFFAOYSA-N
MW275.13 g/mol
LogP3.20
Rot. Bonds2

About 3-(2,6-dichlorophenyl)oxane-4-carboxylic acid

3-(2,6-dichlorophenyl)oxane-4-carboxylic acid (PubChem CID 169208325) has the molecular formula C12H12Cl2O3 and a molecular weight of 275.13 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)oxane-4-carboxylic acid.

Molecular Properties

Compound Name3-(2,6-dichlorophenyl)oxane-4-carboxylic acid
PubChem CID169208325
Molecular FormulaC12H12Cl2O3
Molecular Weight275.13 g/mol
Exact Mass274.02
IUPAC Name3-(2,6-dichlorophenyl)oxane-4-carboxylic acid
SMILESO=C(O)C1CCOCC1c1c(Cl)cccc1Cl
InChIInChI=1S/C12H12Cl2O3/c13-9-2-1-3-10(14)11(9)8-6-17-5-4-7(8)12(15)16/h1-3,7-8H,4-6H2,(H,15,16)
InChIKeyKTJJJWQFGBAUPE-UHFFFAOYSA-N
XLogP3.20
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.13
LogP ≤ 53.20
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-(2,6-dichlorophenyl)oxane-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,6-dichlorophenyl)oxane-4-carboxylic acid?
The IUPAC name of 3-(2,6-dichlorophenyl)oxane-4-carboxylic acid (CID 169208325) is 3-(2,6-dichlorophenyl)oxane-4-carboxylic acid.
What is the SMILES notation for 3-(2,6-dichlorophenyl)oxane-4-carboxylic acid?
The canonical SMILES for 3-(2,6-dichlorophenyl)oxane-4-carboxylic acid is O=C(O)C1CCOCC1c1c(Cl)cccc1Cl.
What is the InChIKey of 3-(2,6-dichlorophenyl)oxane-4-carboxylic acid?
The InChIKey is KTJJJWQFGBAUPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12Cl2O3/c13-9-2-1-3-10(14)11(9)8-6-17-5-4-7(8)12(15)16/h1-3,7-8H,4-6H2,(H,15,16).
What are the key properties of 3-(2,6-dichlorophenyl)oxane-4-carboxylic acid?
3-(2,6-dichlorophenyl)oxane-4-carboxylic acid has a molecular weight of 275.13 g/mol, XLogP of 3.20, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,6-dichlorophenyl)oxane-4-carboxylic acid is sourced from PubChem (CID 169208325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).