C17H23FN2O2 — CID 169209387
2-(2-cyclopropylphenoxy)-N-[(3S,4S)-3-fluoropiperidin-4-yl]propanamide (PubChem CID 169209387) has the molecular formula C17H23FN2O2 and a molecular weight of 306.38 g/mol. Its IUPAC name is 2-(2-cyclopropylphenoxy)-N-[(3S,4S)-3-fluoropiperidin-4-yl]propanamide.
| Compound Name | 2-(2-cyclopropylphenoxy)-N-[(3S,4S)-3-fluoropiperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 169209387 |
| Molecular Formula | C17H23FN2O2 |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 2-(2-cyclopropylphenoxy)-N-[(3S,4S)-3-fluoropiperidin-4-yl]propanamide |
| SMILES | CC(Oc1ccccc1C1CC1)C(=O)N[C@H]1CCNC[C@@H]1F |
| InChI | InChI=1S/C17H23FN2O2/c1-11(17(21)20-15-8-9-19-10-14(15)18)22-16-5-3-2-4-13(16)12-6-7-12/h2-5,11-12,14-15,19H,6-10H2,1H3,(H,20,21)/t11?,14-,15-/m0/s1 |
| InChIKey | WMIYGEKCPSTVIE-CNSWMUILSA-N |
| XLogP | 2.15 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |