About 5-[bis(pyridin-2-ylmethyl)amino]-6-methoxynaphthalene-2-carbonitrile;chlorocopper(1+)
5-[bis(pyridin-2-ylmethyl)amino]-6-methoxynaphthalene-2-carbonitrile;chlorocopper(1+) (PubChem CID 169211481) has the molecular formula C24H20ClCuN4O+
and a molecular weight of 479.45 g/mol. Its IUPAC name is 5-[bis(pyridin-2-ylmethyl)amino]-6-methoxynaphthalene-2-carbonitrile;chlorocopper(1+).
Molecular Properties
| Compound Name | 5-[bis(pyridin-2-ylmethyl)amino]-6-methoxynaphthalene-2-carbonitrile;chlorocopper(1+) |
| PubChem CID | 169211481 |
| Molecular Formula | C24H20ClCuN4O+ |
| Molecular Weight | 479.45 g/mol |
| Exact Mass | 478.06 |
| IUPAC Name | 5-[bis(pyridin-2-ylmethyl)amino]-6-methoxynaphthalene-2-carbonitrile;chlorocopper(1+) |
| SMILES | COc1ccc2cc(C#N)ccc2c1N(Cc1ccccn1)Cc1ccccn1.Cl[Cu+] |
| InChI | InChI=1S/C24H20N4O.ClH.Cu/c1-29-23-11-9-19-14-18(15-25)8-10-22(19)24(23)28(16-20-6-2-4-12-26-20)17-21-7-3-5-13-27-21;;/h2-14H,16-17H2,1H3;1H;/q;;+2/p-1 |
| InChIKey | ZNNNAJBHALUJTA-UHFFFAOYSA-M |
| XLogP | 5.40 |
| TPSA | 62.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.45 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[bis(pyridin-2-ylmethyl)amino]-6-methoxynaphthalene-2-carbonitrile;chlorocopper(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[bis(pyridin-2-ylmethyl)amino]-6-methoxynaphthalene-2-carbonitrile;chlorocopper(1+)?
The IUPAC name of 5-[bis(pyridin-2-ylmethyl)amino]-6-methoxynaphthalene-2-carbonitrile;chlorocopper(1+) (CID 169211481) is 5-[bis(pyridin-2-ylmethyl)amino]-6-methoxynaphthalene-2-carbonitrile;chlorocopper(1+).
What is the SMILES notation for 5-[bis(pyridin-2-ylmethyl)amino]-6-methoxynaphthalene-2-carbonitrile;chlorocopper(1+)?
The canonical SMILES for 5-[bis(pyridin-2-ylmethyl)amino]-6-methoxynaphthalene-2-carbonitrile;chlorocopper(1+) is COc1ccc2cc(C#N)ccc2c1N(Cc1ccccn1)Cc1ccccn1.Cl[Cu+].
What is the InChIKey of 5-[bis(pyridin-2-ylmethyl)amino]-6-methoxynaphthalene-2-carbonitrile;chlorocopper(1+)?
The InChIKey is ZNNNAJBHALUJTA-UHFFFAOYSA-M. The full InChI is InChI=1S/C24H20N4O.ClH.Cu/c1-29-23-11-9-19-14-18(15-25)8-10-22(19)24(23)28(16-20-6-2-4-12-26-20)17-21-7-3-5-13-27-21;;/h2-14H,16-17H2,1H3;1H;/q;;+2/p-1.
What are the key properties of 5-[bis(pyridin-2-ylmethyl)amino]-6-methoxynaphthalene-2-carbonitrile;chlorocopper(1+)?
5-[bis(pyridin-2-ylmethyl)amino]-6-methoxynaphthalene-2-carbonitrile;chlorocopper(1+) has a molecular weight of 479.45 g/mol, XLogP of 5.40, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[bis(pyridin-2-ylmethyl)amino]-6-methoxynaphthalene-2-carbonitrile;chlorocopper(1+) is sourced from PubChem (CID 169211481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).