C17H19N3O3 — CID 169212560
8-acetyl-2-(3-azabicyclo[3.1.0]hexan-3-yl)-6-methoxy-3-methylquinazolin-4-one (PubChem CID 169212560) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is 8-acetyl-2-(3-azabicyclo[3.1.0]hexan-3-yl)-6-methoxy-3-methylquinazolin-4-one.
| Compound Name | 8-acetyl-2-(3-azabicyclo[3.1.0]hexan-3-yl)-6-methoxy-3-methylquinazolin-4-one |
|---|---|
| PubChem CID | 169212560 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 8-acetyl-2-(3-azabicyclo[3.1.0]hexan-3-yl)-6-methoxy-3-methylquinazolin-4-one |
| SMILES | COc1cc(C(C)=O)c2nc(N3CC4CC4C3)n(C)c(=O)c2c1 |
| InChI | InChI=1S/C17H19N3O3/c1-9(21)13-5-12(23-3)6-14-15(13)18-17(19(2)16(14)22)20-7-10-4-11(10)8-20/h5-6,10-11H,4,7-8H2,1-3H3 |
| InChIKey | OERSNQAEQFKVQY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |