C15H29NO3 — CID 169213307
tert-butyl N-(3,3-dimethyl-6-oxoheptyl)-N-methylcarbamate (PubChem CID 169213307) has the molecular formula C15H29NO3 and a molecular weight of 271.40 g/mol. Its IUPAC name is tert-butyl N-(3,3-dimethyl-6-oxoheptyl)-N-methylcarbamate.
| Compound Name | tert-butyl N-(3,3-dimethyl-6-oxoheptyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 169213307 |
| Molecular Formula | C15H29NO3 |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.21 |
| IUPAC Name | tert-butyl N-(3,3-dimethyl-6-oxoheptyl)-N-methylcarbamate |
| SMILES | CC(=O)CCC(C)(C)CCN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H29NO3/c1-12(17)8-9-15(5,6)10-11-16(7)13(18)19-14(2,3)4/h8-11H2,1-7H3 |
| InChIKey | MFQJGBIZXCCMMS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |