C29H30N4O4 — CID 169213684
2-[5-[[3-[7-(6-aminohexyl)isoquinolin-4-yl]benzoyl]amino]-2-oxo-1-pyridinyl]acetic acid (PubChem CID 169213684) has the molecular formula C29H30N4O4 and a molecular weight of 498.58 g/mol. Its IUPAC name is 2-[5-[[3-[7-(6-aminohexyl)isoquinolin-4-yl]benzoyl]amino]-2-oxo-1-pyridinyl]acetic acid.
| Compound Name | 2-[5-[[3-[7-(6-aminohexyl)isoquinolin-4-yl]benzoyl]amino]-2-oxo-1-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 169213684 |
| Molecular Formula | C29H30N4O4 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | 2-[5-[[3-[7-(6-aminohexyl)isoquinolin-4-yl]benzoyl]amino]-2-oxo-1-pyridinyl]acetic acid |
| SMILES | NCCCCCCc1ccc2c(-c3cccc(C(=O)Nc4ccc(=O)n(CC(=O)O)c4)c3)cncc2c1 |
| InChI | InChI=1S/C29H30N4O4/c30-13-4-2-1-3-6-20-9-11-25-23(14-20)16-31-17-26(25)21-7-5-8-22(15-21)29(37)32-24-10-12-27(34)33(18-24)19-28(35)36/h5,7-12,14-18H,1-4,6,13,19,30H2,(H,32,37)(H,35,36) |
| InChIKey | SCQUCCYIRITAQF-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|