C31H38N4O4 — CID 169214939
ethyl 2-[5-[[3-[3-(cyclohexylmethylamino)propyl]-5-pyridin-3-ylbenzoyl]amino]-2-oxo-1-pyridinyl]acetate (PubChem CID 169214939) has the molecular formula C31H38N4O4 and a molecular weight of 530.67 g/mol. Its IUPAC name is ethyl 2-[5-[[3-[3-(cyclohexylmethylamino)propyl]-5-pyridin-3-ylbenzoyl]amino]-2-oxo-1-pyridinyl]acetate.
| Compound Name | ethyl 2-[5-[[3-[3-(cyclohexylmethylamino)propyl]-5-pyridin-3-ylbenzoyl]amino]-2-oxo-1-pyridinyl]acetate |
|---|---|
| PubChem CID | 169214939 |
| Molecular Formula | C31H38N4O4 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | ethyl 2-[5-[[3-[3-(cyclohexylmethylamino)propyl]-5-pyridin-3-ylbenzoyl]amino]-2-oxo-1-pyridinyl]acetate |
| SMILES | CCOC(=O)Cn1cc(NC(=O)c2cc(CCCNCC3CCCCC3)cc(-c3cccnc3)c2)ccc1=O |
| InChI | InChI=1S/C31H38N4O4/c1-2-39-30(37)22-35-21-28(12-13-29(35)36)34-31(38)27-17-24(16-26(18-27)25-11-7-15-33-20-25)10-6-14-32-19-23-8-4-3-5-9-23/h7,11-13,15-18,20-21,23,32H,2-6,8-10,14,19,22H2,1H3,(H,34,38) |
| InChIKey | GCLNFDIXFGLRDO-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|