C23H25N3O4 — CID 169214788
methyl 2-[5-[[3-ethyl-5-[(1E,3Z)-1-(methylideneamino)penta-1,3-dien-2-yl]benzoyl]amino]-2-oxo-1-pyridinyl]acetate (PubChem CID 169214788) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is methyl 2-[5-[[3-ethyl-5-[(1E,3Z)-1-(methylideneamino)penta-1,3-dien-2-yl]benzoyl]amino]-2-oxo-1-pyridinyl]acetate.
| Compound Name | methyl 2-[5-[[3-ethyl-5-[(1E,3Z)-1-(methylideneamino)penta-1,3-dien-2-yl]benzoyl]amino]-2-oxo-1-pyridinyl]acetate |
|---|---|
| PubChem CID | 169214788 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | methyl 2-[5-[[3-ethyl-5-[(1E,3Z)-1-(methylideneamino)penta-1,3-dien-2-yl]benzoyl]amino]-2-oxo-1-pyridinyl]acetate |
| SMILES | C=N/C=C(\C=C/C)c1cc(CC)cc(C(=O)Nc2ccc(=O)n(CC(=O)OC)c2)c1 |
| InChI | InChI=1S/C23H25N3O4/c1-5-7-17(13-24-3)18-10-16(6-2)11-19(12-18)23(29)25-20-8-9-21(27)26(14-20)15-22(28)30-4/h5,7-14H,3,6,15H2,1-2,4H3,(H,25,29)/b7-5-,17-13+ |
| InChIKey | LIZUNUJMLIBOSM-YIXWMRGVSA-N |
| XLogP | 3.45 |
| TPSA | 89.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|