C33H35N3O6 — CID 169214453
9-[4-[3-[[1-(2-methoxy-2-oxoethyl)-6-oxo-3-pyridinyl]carbamoyl]phenyl]isoquinolin-7-yl]nonanoic acid (PubChem CID 169214453) has the molecular formula C33H35N3O6 and a molecular weight of 569.66 g/mol. Its IUPAC name is 9-[4-[3-[[1-(2-methoxy-2-oxoethyl)-6-oxo-3-pyridinyl]carbamoyl]phenyl]isoquinolin-7-yl]nonanoic acid.
| Compound Name | 9-[4-[3-[[1-(2-methoxy-2-oxoethyl)-6-oxo-3-pyridinyl]carbamoyl]phenyl]isoquinolin-7-yl]nonanoic acid |
|---|---|
| PubChem CID | 169214453 |
| Molecular Formula | C33H35N3O6 |
| Molecular Weight | 569.66 g/mol |
| Exact Mass | 569.25 |
| IUPAC Name | 9-[4-[3-[[1-(2-methoxy-2-oxoethyl)-6-oxo-3-pyridinyl]carbamoyl]phenyl]isoquinolin-7-yl]nonanoic acid |
| SMILES | COC(=O)Cn1cc(NC(=O)c2cccc(-c3cncc4cc(CCCCCCCCC(=O)O)ccc34)c2)ccc1=O |
| InChI | InChI=1S/C33H35N3O6/c1-42-32(40)22-36-21-27(14-16-30(36)37)35-33(41)25-11-8-10-24(18-25)29-20-34-19-26-17-23(13-15-28(26)29)9-6-4-2-3-5-7-12-31(38)39/h8,10-11,13-21H,2-7,9,12,22H2,1H3,(H,35,41)(H,38,39) |
| InChIKey | PKSCLERHHMYXCA-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.66 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|