About N-ethylpropan-2-amine;molecular hydrogen;4-prop-2-enylmorpholine
N-ethylpropan-2-amine;molecular hydrogen;4-prop-2-enylmorpholine (PubChem CID 169215022) has the molecular formula C12H28N2O
and a molecular weight of 216.37 g/mol. Its IUPAC name is N-ethylpropan-2-amine;molecular hydrogen;4-prop-2-enylmorpholine.
Molecular Properties
| Compound Name | N-ethylpropan-2-amine;molecular hydrogen;4-prop-2-enylmorpholine |
| PubChem CID | 169215022 |
| Molecular Formula | C12H28N2O |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.22 |
| IUPAC Name | N-ethylpropan-2-amine;molecular hydrogen;4-prop-2-enylmorpholine |
| SMILES | C=CCN1CCOCC1.CCNC(C)C.[H][H] |
| InChI | InChI=1S/C7H13NO.C5H13N.H2/c1-2-3-8-4-6-9-7-5-8;1-4-6-5(2)3;/h2H,1,3-7H2;5-6H,4H2,1-3H3;1H |
| InChIKey | OTHUXTCXDIQCBH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-ethylpropan-2-amine;molecular hydrogen;4-prop-2-enylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylpropan-2-amine;molecular hydrogen;4-prop-2-enylmorpholine?
The IUPAC name of N-ethylpropan-2-amine;molecular hydrogen;4-prop-2-enylmorpholine (CID 169215022) is N-ethylpropan-2-amine;molecular hydrogen;4-prop-2-enylmorpholine.
What is the SMILES notation for N-ethylpropan-2-amine;molecular hydrogen;4-prop-2-enylmorpholine?
The canonical SMILES for N-ethylpropan-2-amine;molecular hydrogen;4-prop-2-enylmorpholine is C=CCN1CCOCC1.CCNC(C)C.[H][H].
What is the InChIKey of N-ethylpropan-2-amine;molecular hydrogen;4-prop-2-enylmorpholine?
The InChIKey is OTHUXTCXDIQCBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO.C5H13N.H2/c1-2-3-8-4-6-9-7-5-8;1-4-6-5(2)3;/h2H,1,3-7H2;5-6H,4H2,1-3H3;1H.
What are the key properties of N-ethylpropan-2-amine;molecular hydrogen;4-prop-2-enylmorpholine?
N-ethylpropan-2-amine;molecular hydrogen;4-prop-2-enylmorpholine has a molecular weight of 216.37 g/mol, XLogP of 1.75, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylpropan-2-amine;molecular hydrogen;4-prop-2-enylmorpholine is sourced from PubChem (CID 169215022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).