C25H27N5O4S — CID 169217637
N-(2,6-dimethoxyphenyl)sulfanyl-4-methoxy-6-(3-piperazin-1-ylphenyl)-[1,2]oxazolo[5,4-b]pyridin-3-amine (PubChem CID 169217637) has the molecular formula C25H27N5O4S and a molecular weight of 493.59 g/mol. Its IUPAC name is N-(2,6-dimethoxyphenyl)sulfanyl-4-methoxy-6-(3-piperazin-1-ylphenyl)-[1,2]oxazolo[5,4-b]pyridin-3-amine.
| Compound Name | N-(2,6-dimethoxyphenyl)sulfanyl-4-methoxy-6-(3-piperazin-1-ylphenyl)-[1,2]oxazolo[5,4-b]pyridin-3-amine |
|---|---|
| PubChem CID | 169217637 |
| Molecular Formula | C25H27N5O4S |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | N-(2,6-dimethoxyphenyl)sulfanyl-4-methoxy-6-(3-piperazin-1-ylphenyl)-[1,2]oxazolo[5,4-b]pyridin-3-amine |
| SMILES | COc1cccc(OC)c1SNc1noc2nc(-c3cccc(N4CCNCC4)c3)cc(OC)c12 |
| InChI | InChI=1S/C25H27N5O4S/c1-31-19-8-5-9-20(32-2)23(19)35-29-24-22-21(33-3)15-18(27-25(22)34-28-24)16-6-4-7-17(14-16)30-12-10-26-11-13-30/h4-9,14-15,26H,10-13H2,1-3H3,(H,28,29) |
| InChIKey | VNKONGYBLMVUHE-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 93.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|