C11H22N2O — CID 169218017
ethane;3-methyl-2,4,6,7-tetrahydropyrano[4,3-c]pyrazole (PubChem CID 169218017) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is ethane;3-methyl-2,4,6,7-tetrahydropyrano[4,3-c]pyrazole.
| Compound Name | ethane;3-methyl-2,4,6,7-tetrahydropyrano[4,3-c]pyrazole |
|---|---|
| PubChem CID | 169218017 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | ethane;3-methyl-2,4,6,7-tetrahydropyrano[4,3-c]pyrazole |
| SMILES | CC.CC.Cc1[nH]nc2c1COCC2 |
| InChI | InChI=1S/C7H10N2O.2C2H6/c1-5-6-4-10-3-2-7(6)9-8-5;2*1-2/h2-4H2,1H3,(H,8,9);2*1-2H3 |
| InChIKey | FDPISICKAZQDMY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |