C24H23ClF3N3O — CID 169218335
N-[4-[4-amino-6-chloro-2-(trifluoromethyl)quinolin-5-yl]cyclohexyl]-2-methylbenzamide (PubChem CID 169218335) has the molecular formula C24H23ClF3N3O and a molecular weight of 461.92 g/mol. Its IUPAC name is N-[4-[4-amino-6-chloro-2-(trifluoromethyl)quinolin-5-yl]cyclohexyl]-2-methylbenzamide.
| Compound Name | N-[4-[4-amino-6-chloro-2-(trifluoromethyl)quinolin-5-yl]cyclohexyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 169218335 |
| Molecular Formula | C24H23ClF3N3O |
| Molecular Weight | 461.92 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | N-[4-[4-amino-6-chloro-2-(trifluoromethyl)quinolin-5-yl]cyclohexyl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)NC1CCC(c2c(Cl)ccc3nc(C(F)(F)F)cc(N)c23)CC1 |
| InChI | InChI=1S/C24H23ClF3N3O/c1-13-4-2-3-5-16(13)23(32)30-15-8-6-14(7-9-15)21-17(25)10-11-19-22(21)18(29)12-20(31-19)24(26,27)28/h2-5,10-12,14-15H,6-9H2,1H3,(H2,29,31)(H,30,32) |
| InChIKey | LYHLJOVEFAVQST-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.92 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |