C28H37BF3N4OS — CID 169218575
CID 169218575 (PubChem CID 169218575) has the molecular formula C28H37BF3N4OS and a molecular weight of 545.50 g/mol.
| Compound Name | CID 169218575 |
|---|---|
| PubChem CID | 169218575 |
| Molecular Formula | C28H37BF3N4OS |
| Molecular Weight | 545.50 g/mol |
| Exact Mass | 545.27 |
| IUPAC Name | — |
| SMILES | C[B]C(C)c1c(Nc2ccc([C@H](N(C)C(=O)C(CCC)CCC)C(F)(F)F)cc2)cnc2c1NC=C(C)S2 |
| InChI | InChI=1S/C28H37BF3N4OS/c1-7-9-20(10-8-2)27(37)36(6)25(28(30,31)32)19-11-13-21(14-12-19)35-22-16-34-26-24(23(22)18(4)29-5)33-15-17(3)38-26/h11-16,18,20,25,33,35H,7-10H2,1-6H3/t18?,25-/m0/s1 |
| InChIKey | NRHGDXGLGBRJRG-LYIYLXCWSA-N |
| XLogP | 8.30 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.50 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|