C27H22N4O4 — CID 169219981
6-[4-[3-[(6-methoxy-3-oxo-2-benzofuran-1-ylidene)methyl]benzoyl]piperazin-1-yl]pyridine-3-carbonitrile (PubChem CID 169219981) has the molecular formula C27H22N4O4 and a molecular weight of 466.50 g/mol. Its IUPAC name is 6-[4-[3-[(6-methoxy-3-oxo-2-benzofuran-1-ylidene)methyl]benzoyl]piperazin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 6-[4-[3-[(6-methoxy-3-oxo-2-benzofuran-1-ylidene)methyl]benzoyl]piperazin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 169219981 |
| Molecular Formula | C27H22N4O4 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 6-[4-[3-[(6-methoxy-3-oxo-2-benzofuran-1-ylidene)methyl]benzoyl]piperazin-1-yl]pyridine-3-carbonitrile |
| SMILES | COc1ccc2c(c1)C(=Cc1cccc(C(=O)N3CCN(c4ccc(C#N)cn4)CC3)c1)OC2=O |
| InChI | InChI=1S/C27H22N4O4/c1-34-21-6-7-22-23(15-21)24(35-27(22)33)14-18-3-2-4-20(13-18)26(32)31-11-9-30(10-12-31)25-8-5-19(16-28)17-29-25/h2-8,13-15,17H,9-12H2,1H3 |
| InChIKey | BLGUHADDBLWMSK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 95.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|