C33H28N4O4 — CID 169219872
[(Z)-2-[3-[4-(5-cyano-2-pyridinyl)piperazine-1-carbonyl]phenyl]-1-(2-methyl-5-phenoxyphenyl)ethenyl] formate (PubChem CID 169219872) has the molecular formula C33H28N4O4 and a molecular weight of 544.61 g/mol. Its IUPAC name is [(Z)-2-[3-[4-(5-cyano-2-pyridinyl)piperazine-1-carbonyl]phenyl]-1-(2-methyl-5-phenoxyphenyl)ethenyl] formate.
| Compound Name | [(Z)-2-[3-[4-(5-cyano-2-pyridinyl)piperazine-1-carbonyl]phenyl]-1-(2-methyl-5-phenoxyphenyl)ethenyl] formate |
|---|---|
| PubChem CID | 169219872 |
| Molecular Formula | C33H28N4O4 |
| Molecular Weight | 544.61 g/mol |
| Exact Mass | 544.21 |
| IUPAC Name | [(Z)-2-[3-[4-(5-cyano-2-pyridinyl)piperazine-1-carbonyl]phenyl]-1-(2-methyl-5-phenoxyphenyl)ethenyl] formate |
| SMILES | Cc1ccc(Oc2ccccc2)cc1/C(=C/c1cccc(C(=O)N2CCN(c3ccc(C#N)cn3)CC2)c1)OC=O |
| InChI | InChI=1S/C33H28N4O4/c1-24-10-12-29(41-28-8-3-2-4-9-28)20-30(24)31(40-23-38)19-25-6-5-7-27(18-25)33(39)37-16-14-36(15-17-37)32-13-11-26(21-34)22-35-32/h2-13,18-20,22-23H,14-17H2,1H3/b31-19- |
| InChIKey | XWDMRROWXKFSMM-DXJNIWACSA-N |
| XLogP | 5.69 |
| TPSA | 95.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.61 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|