C14H19N2O4P — CID 169222483
[3-[2-[methyl(prop-2-enyl)amino]ethyl]-1H-indol-5-yl] dihydrogen phosphate (PubChem CID 169222483) has the molecular formula C14H19N2O4P and a molecular weight of 310.29 g/mol. Its IUPAC name is [3-[2-[methyl(prop-2-enyl)amino]ethyl]-1H-indol-5-yl] dihydrogen phosphate.
| Compound Name | [3-[2-[methyl(prop-2-enyl)amino]ethyl]-1H-indol-5-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 169222483 |
| Molecular Formula | C14H19N2O4P |
| Molecular Weight | 310.29 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | [3-[2-[methyl(prop-2-enyl)amino]ethyl]-1H-indol-5-yl] dihydrogen phosphate |
| SMILES | C=CCN(C)CCc1c[nH]c2ccc(OP(=O)(O)O)cc12 |
| InChI | InChI=1S/C14H19N2O4P/c1-3-7-16(2)8-6-11-10-15-14-5-4-12(9-13(11)14)20-21(17,18)19/h3-5,9-10,15H,1,6-8H2,2H3,(H2,17,18,19) |
| InChIKey | RAUJBAWMSSNWDG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 85.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.29 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|