C19H15BrN2O3 — CID 169223028
ethyl 3-pyridin-1-ium-1-yl-[1]benzofuro[3,2-b]pyridine-2-carboxylate bromide (PubChem CID 169223028) has the molecular formula C19H15BrN2O3 and a molecular weight of 399.24 g/mol. Its IUPAC name is ethyl 3-pyridin-1-ium-1-yl-[1]benzofuro[3,2-b]pyridine-2-carboxylate bromide.
| Compound Name | ethyl 3-pyridin-1-ium-1-yl-[1]benzofuro[3,2-b]pyridine-2-carboxylate bromide |
|---|---|
| PubChem CID | 169223028 |
| Molecular Formula | C19H15BrN2O3 |
| Molecular Weight | 399.24 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | ethyl 3-pyridin-1-ium-1-yl-[1]benzofuro[3,2-b]pyridine-2-carboxylate bromide |
| SMILES | CCOC(=O)c1nc2c(cc1-[n+]1ccccc1)oc1ccccc12.[Br-] |
| InChI | InChI=1S/C19H15N2O3.BrH/c1-2-23-19(22)18-14(21-10-6-3-7-11-21)12-16-17(20-18)13-8-4-5-9-15(13)24-16;/h3-12H,2H2,1H3;1H/q+1;/p-1 |
| InChIKey | WFWNBVGAVXEYNM-UHFFFAOYSA-M |
| XLogP | 0.44 |
| TPSA | 56.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.24 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|