C18H31FN4O2 — CID 169223575
methyl 4-[3-[4-(3-aminopropylamino)butylamino]propylamino]-3-fluorobenzoate (PubChem CID 169223575) has the molecular formula C18H31FN4O2 and a molecular weight of 354.47 g/mol. Its IUPAC name is methyl 4-[3-[4-(3-aminopropylamino)butylamino]propylamino]-3-fluorobenzoate.
| Compound Name | methyl 4-[3-[4-(3-aminopropylamino)butylamino]propylamino]-3-fluorobenzoate |
|---|---|
| PubChem CID | 169223575 |
| Molecular Formula | C18H31FN4O2 |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | methyl 4-[3-[4-(3-aminopropylamino)butylamino]propylamino]-3-fluorobenzoate |
| SMILES | COC(=O)c1ccc(NCCCNCCCCNCCCN)c(F)c1 |
| InChI | InChI=1S/C18H31FN4O2/c1-25-18(24)15-6-7-17(16(19)14-15)23-13-5-12-22-10-3-2-9-21-11-4-8-20/h6-7,14,21-23H,2-5,8-13,20H2,1H3 |
| InChIKey | KDGGOFHGQPFPKQ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|