C27H40FN5O4 — CID 169223394
methyl 4-[3-[4-(3-aminopropylamino)butylamino]propylamino]-5-fluoro-2-(2-phenylethoxycarbonylamino)benzoate (PubChem CID 169223394) has the molecular formula C27H40FN5O4 and a molecular weight of 517.65 g/mol. Its IUPAC name is methyl 4-[3-[4-(3-aminopropylamino)butylamino]propylamino]-5-fluoro-2-(2-phenylethoxycarbonylamino)benzoate.
| Compound Name | methyl 4-[3-[4-(3-aminopropylamino)butylamino]propylamino]-5-fluoro-2-(2-phenylethoxycarbonylamino)benzoate |
|---|---|
| PubChem CID | 169223394 |
| Molecular Formula | C27H40FN5O4 |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.31 |
| IUPAC Name | methyl 4-[3-[4-(3-aminopropylamino)butylamino]propylamino]-5-fluoro-2-(2-phenylethoxycarbonylamino)benzoate |
| SMILES | COC(=O)c1cc(F)c(NCCCNCCCCNCCCN)cc1NC(=O)OCCc1ccccc1 |
| InChI | InChI=1S/C27H40FN5O4/c1-36-26(34)22-19-23(28)25(32-17-8-16-31-14-6-5-13-30-15-7-12-29)20-24(22)33-27(35)37-18-11-21-9-3-2-4-10-21/h2-4,9-10,19-20,30-32H,5-8,11-18,29H2,1H3,(H,33,35) |
| InChIKey | PNNHEDNNNBRYFJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|