C22H23BrN2O2 — CID 169224423
6-bromo-3,5-bis[(4-methoxyphenyl)methyl]-4-methylpyridin-2-amine (PubChem CID 169224423) has the molecular formula C22H23BrN2O2 and a molecular weight of 427.34 g/mol. Its IUPAC name is 6-bromo-3,5-bis[(4-methoxyphenyl)methyl]-4-methylpyridin-2-amine.
| Compound Name | 6-bromo-3,5-bis[(4-methoxyphenyl)methyl]-4-methylpyridin-2-amine |
|---|---|
| PubChem CID | 169224423 |
| Molecular Formula | C22H23BrN2O2 |
| Molecular Weight | 427.34 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 6-bromo-3,5-bis[(4-methoxyphenyl)methyl]-4-methylpyridin-2-amine |
| SMILES | COc1ccc(Cc2c(N)nc(Br)c(Cc3ccc(OC)cc3)c2C)cc1 |
| InChI | InChI=1S/C22H23BrN2O2/c1-14-19(12-15-4-8-17(26-2)9-5-15)21(23)25-22(24)20(14)13-16-6-10-18(27-3)11-7-16/h4-11H,12-13H2,1-3H3,(H2,24,25) |
| InChIKey | QTDMVXKANIWQBW-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.34 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|