C25H25N3O2 — CID 175277942
4,5-bis[(4-methoxyphenyl)methyl]quinoline-2,3-diamine (PubChem CID 175277942) has the molecular formula C25H25N3O2 and a molecular weight of 399.49 g/mol. Its IUPAC name is 4,5-bis[(4-methoxyphenyl)methyl]quinoline-2,3-diamine.
| Compound Name | 4,5-bis[(4-methoxyphenyl)methyl]quinoline-2,3-diamine |
|---|---|
| PubChem CID | 175277942 |
| Molecular Formula | C25H25N3O2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 4,5-bis[(4-methoxyphenyl)methyl]quinoline-2,3-diamine |
| SMILES | COc1ccc(Cc2cccc3nc(N)c(N)c(Cc4ccc(OC)cc4)c23)cc1 |
| InChI | InChI=1S/C25H25N3O2/c1-29-19-10-6-16(7-11-19)14-18-4-3-5-22-23(18)21(24(26)25(27)28-22)15-17-8-12-20(30-2)13-9-17/h3-13H,14-15,26H2,1-2H3,(H2,27,28) |
| InChIKey | DOSZJSLKBPCRTP-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |