C27H27N3O3S — CID 169225092
N-[5-(4-hydroxy-4-phenylpiperidin-1-yl)quinolin-8-yl]-4-methylbenzenesulfonamide (PubChem CID 169225092) has the molecular formula C27H27N3O3S and a molecular weight of 473.60 g/mol. Its IUPAC name is N-[5-(4-hydroxy-4-phenylpiperidin-1-yl)quinolin-8-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[5-(4-hydroxy-4-phenylpiperidin-1-yl)quinolin-8-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 169225092 |
| Molecular Formula | C27H27N3O3S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | N-[5-(4-hydroxy-4-phenylpiperidin-1-yl)quinolin-8-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(N3CCC(O)(c4ccccc4)CC3)c3cccnc23)cc1 |
| InChI | InChI=1S/C27H27N3O3S/c1-20-9-11-22(12-10-20)34(32,33)29-24-13-14-25(23-8-5-17-28-26(23)24)30-18-15-27(31,16-19-30)21-6-3-2-4-7-21/h2-14,17,29,31H,15-16,18-19H2,1H3 |
| InChIKey | LRQJZOFERWQIJA-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |