C20H16O3 — CID 169225490
(2S)-4-benzylspiro[naphthalene-2,5'-oxolane]-1,2'-dione (PubChem CID 169225490) has the molecular formula C20H16O3 and a molecular weight of 304.34 g/mol. Its IUPAC name is (2S)-4-benzylspiro[naphthalene-2,5'-oxolane]-1,2'-dione.
| Compound Name | (2S)-4-benzylspiro[naphthalene-2,5'-oxolane]-1,2'-dione |
|---|---|
| PubChem CID | 169225490 |
| Molecular Formula | C20H16O3 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | (2S)-4-benzylspiro[naphthalene-2,5'-oxolane]-1,2'-dione |
| SMILES | O=C1CC[C@@]2(C=C(Cc3ccccc3)c3ccccc3C2=O)O1 |
| InChI | InChI=1S/C20H16O3/c21-18-10-11-20(23-18)13-15(12-14-6-2-1-3-7-14)16-8-4-5-9-17(16)19(20)22/h1-9,13H,10-12H2/t20-/m0/s1 |
| InChIKey | JBVNCMCKWAQCJI-FQEVSTJZSA-N |
| XLogP | 3.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |