C25H21NO7 — CID 169226655
2-[1-(9H-fluoren-9-ylmethoxycarbonyloxy)propan-2-yl]-3-nitrobenzoic acid (PubChem CID 169226655) has the molecular formula C25H21NO7 and a molecular weight of 447.44 g/mol. Its IUPAC name is 2-[1-(9H-fluoren-9-ylmethoxycarbonyloxy)propan-2-yl]-3-nitrobenzoic acid.
| Compound Name | 2-[1-(9H-fluoren-9-ylmethoxycarbonyloxy)propan-2-yl]-3-nitrobenzoic acid |
|---|---|
| PubChem CID | 169226655 |
| Molecular Formula | C25H21NO7 |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 2-[1-(9H-fluoren-9-ylmethoxycarbonyloxy)propan-2-yl]-3-nitrobenzoic acid |
| SMILES | CC(COC(=O)OCC1c2ccccc2-c2ccccc21)c1c(C(=O)O)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H21NO7/c1-15(23-20(24(27)28)11-6-12-22(23)26(30)31)13-32-25(29)33-14-21-18-9-4-2-7-16(18)17-8-3-5-10-19(17)21/h2-12,15,21H,13-14H2,1H3,(H,27,28) |
| InChIKey | NZMMXPMQYXUNQU-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|