C18H11ClN2O4S — CID 169226681
(E)-3-(6-chloro-7-methyl-4-oxochromen-3-yl)-2-pyridin-2-ylsulfonylprop-2-enenitrile (PubChem CID 169226681) has the molecular formula C18H11ClN2O4S and a molecular weight of 386.82 g/mol. Its IUPAC name is (E)-3-(6-chloro-7-methyl-4-oxochromen-3-yl)-2-pyridin-2-ylsulfonylprop-2-enenitrile.
| Compound Name | (E)-3-(6-chloro-7-methyl-4-oxochromen-3-yl)-2-pyridin-2-ylsulfonylprop-2-enenitrile |
|---|---|
| PubChem CID | 169226681 |
| Molecular Formula | C18H11ClN2O4S |
| Molecular Weight | 386.82 g/mol |
| Exact Mass | 386.01 |
| IUPAC Name | (E)-3-(6-chloro-7-methyl-4-oxochromen-3-yl)-2-pyridin-2-ylsulfonylprop-2-enenitrile |
| SMILES | Cc1cc2occ(/C=C(\C#N)S(=O)(=O)c3ccccn3)c(=O)c2cc1Cl |
| InChI | InChI=1S/C18H11ClN2O4S/c1-11-6-16-14(8-15(11)19)18(22)12(10-25-16)7-13(9-20)26(23,24)17-4-2-3-5-21-17/h2-8,10H,1H3/b13-7+ |
| InChIKey | FJIKYANOZXHSAL-NTUHNPAUSA-N |
| XLogP | 3.49 |
| TPSA | 101.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.82 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|