C18H14F2O2 — CID 169228106
(5,6-difluoro-4-phenylmethoxynaphthalen-2-yl)methanol (PubChem CID 169228106) has the molecular formula C18H14F2O2 and a molecular weight of 300.30 g/mol. Its IUPAC name is (5,6-difluoro-4-phenylmethoxynaphthalen-2-yl)methanol.
| Compound Name | (5,6-difluoro-4-phenylmethoxynaphthalen-2-yl)methanol |
|---|---|
| PubChem CID | 169228106 |
| Molecular Formula | C18H14F2O2 |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | (5,6-difluoro-4-phenylmethoxynaphthalen-2-yl)methanol |
| SMILES | OCc1cc(OCc2ccccc2)c2c(F)c(F)ccc2c1 |
| InChI | InChI=1S/C18H14F2O2/c19-15-7-6-14-8-13(10-21)9-16(17(14)18(15)20)22-11-12-4-2-1-3-5-12/h1-9,21H,10-11H2 |
| InChIKey | GTECQVYZYILWHW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.30 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |