C19H15F2NO2 — CID 165437531
[2-(3,4-difluorophenyl)-6-phenylmethoxy-4-pyridinyl]methanol (PubChem CID 165437531) has the molecular formula C19H15F2NO2 and a molecular weight of 327.33 g/mol. Its IUPAC name is [2-(3,4-difluorophenyl)-6-phenylmethoxy-4-pyridinyl]methanol.
| Compound Name | [2-(3,4-difluorophenyl)-6-phenylmethoxy-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 165437531 |
| Molecular Formula | C19H15F2NO2 |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | [2-(3,4-difluorophenyl)-6-phenylmethoxy-4-pyridinyl]methanol |
| SMILES | OCc1cc(OCc2ccccc2)nc(-c2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C19H15F2NO2/c20-16-7-6-15(10-17(16)21)18-8-14(11-23)9-19(22-18)24-12-13-4-2-1-3-5-13/h1-10,23H,11-12H2 |
| InChIKey | XLCHYRAEIZKJFL-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |