C19H29NO2 — CID 169232113
[2-[(5Z)-5-ethenylocta-5,7-dienyl]cyclopropyl]-(4-hydroxypiperidin-1-yl)methanone (PubChem CID 169232113) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is [2-[(5Z)-5-ethenylocta-5,7-dienyl]cyclopropyl]-(4-hydroxypiperidin-1-yl)methanone.
| Compound Name | [2-[(5Z)-5-ethenylocta-5,7-dienyl]cyclopropyl]-(4-hydroxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 169232113 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | [2-[(5Z)-5-ethenylocta-5,7-dienyl]cyclopropyl]-(4-hydroxypiperidin-1-yl)methanone |
| SMILES | C=C/C=C(\C=C)CCCCC1CC1C(=O)N1CCC(O)CC1 |
| InChI | InChI=1S/C19H29NO2/c1-3-7-15(4-2)8-5-6-9-16-14-18(16)19(22)20-12-10-17(21)11-13-20/h3-4,7,16-18,21H,1-2,5-6,8-14H2/b15-7+ |
| InChIKey | MYHNGLZCKOCMOS-VIZOYTHASA-N |
| XLogP | 3.46 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|