C20H31NO2 — CID 169232138
[2-(5-cyclohexa-1,5-dien-1-ylpentyl)cyclopropyl]-(4-hydroxypiperidin-1-yl)methanone (PubChem CID 169232138) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is [2-(5-cyclohexa-1,5-dien-1-ylpentyl)cyclopropyl]-(4-hydroxypiperidin-1-yl)methanone.
| Compound Name | [2-(5-cyclohexa-1,5-dien-1-ylpentyl)cyclopropyl]-(4-hydroxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 169232138 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | [2-(5-cyclohexa-1,5-dien-1-ylpentyl)cyclopropyl]-(4-hydroxypiperidin-1-yl)methanone |
| SMILES | O=C(C1CC1CCCCCC1=CCCC=C1)N1CCC(O)CC1 |
| InChI | InChI=1S/C20H31NO2/c22-18-11-13-21(14-12-18)20(23)19-15-17(19)10-6-2-5-9-16-7-3-1-4-8-16/h3,7-8,17-19,22H,1-2,4-6,9-15H2 |
| InChIKey | HMUJMNMEONECTN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|