C21H33NO2 — CID 169232128
[3-(5-cyclohexa-1,5-dien-1-ylpentyl)cyclobutyl]-(4-hydroxypiperidin-1-yl)methanone (PubChem CID 169232128) has the molecular formula C21H33NO2 and a molecular weight of 331.50 g/mol. Its IUPAC name is [3-(5-cyclohexa-1,5-dien-1-ylpentyl)cyclobutyl]-(4-hydroxypiperidin-1-yl)methanone.
| Compound Name | [3-(5-cyclohexa-1,5-dien-1-ylpentyl)cyclobutyl]-(4-hydroxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 169232128 |
| Molecular Formula | C21H33NO2 |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.25 |
| IUPAC Name | [3-(5-cyclohexa-1,5-dien-1-ylpentyl)cyclobutyl]-(4-hydroxypiperidin-1-yl)methanone |
| SMILES | O=C(C1CC(CCCCCC2=CCCC=C2)C1)N1CCC(O)CC1 |
| InChI | InChI=1S/C21H33NO2/c23-20-11-13-22(14-12-20)21(24)19-15-18(16-19)10-6-2-5-9-17-7-3-1-4-8-17/h3,7-8,18-20,23H,1-2,4-6,9-16H2 |
| InChIKey | IYVQQGUTILBQAR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|