C12H15N3O2 — CID 169233110
methyl 6-tert-butyl-5H-pyrrolo[2,3-b]pyrazine-3-carboxylate (PubChem CID 169233110) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is methyl 6-tert-butyl-5H-pyrrolo[2,3-b]pyrazine-3-carboxylate.
| Compound Name | methyl 6-tert-butyl-5H-pyrrolo[2,3-b]pyrazine-3-carboxylate |
|---|---|
| PubChem CID | 169233110 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | methyl 6-tert-butyl-5H-pyrrolo[2,3-b]pyrazine-3-carboxylate |
| SMILES | COC(=O)c1cnc2cc(C(C)(C)C)[nH]c2n1 |
| InChI | InChI=1S/C12H15N3O2/c1-12(2,3)9-5-7-10(15-9)14-8(6-13-7)11(16)17-4/h5-6H,1-4H3,(H,14,15) |
| InChIKey | CFIYCNKLJRIMBS-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |