methyl 1,2-dihydropteridine-6-carboxylate

C8H8N4O2 — CID 141110396

IUPACmethyl 1,2-dihydropteridine-6-carboxylate
SMILESCOC(=O)c1cnc2c(n1)C=NCN2
InChIInChI=1S/C8H8N4O2/c1-14-8(13)6-3-10-7-5(12-6)2-9-4-11-7/h2-3H,4H2,1H3,(H,10,11)
InChIKeyDFKHGJLZFBHUMX-UHFFFAOYSA-N
MW192.18 g/mol
LogP0.07
Rot. Bonds1

About methyl 1,2-dihydropteridine-6-carboxylate

methyl 1,2-dihydropteridine-6-carboxylate (PubChem CID 141110396) has the molecular formula C8H8N4O2 and a molecular weight of 192.18 g/mol. Its IUPAC name is methyl 1,2-dihydropteridine-6-carboxylate.

Molecular Properties

Compound Namemethyl 1,2-dihydropteridine-6-carboxylate
PubChem CID141110396
Molecular FormulaC8H8N4O2
Molecular Weight192.18 g/mol
Exact Mass192.06
IUPAC Namemethyl 1,2-dihydropteridine-6-carboxylate
SMILESCOC(=O)c1cnc2c(n1)C=NCN2
InChIInChI=1S/C8H8N4O2/c1-14-8(13)6-3-10-7-5(12-6)2-9-4-11-7/h2-3H,4H2,1H3,(H,10,11)
InChIKeyDFKHGJLZFBHUMX-UHFFFAOYSA-N
XLogP0.07
TPSA76.47 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.18
LogP ≤ 50.07
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze methyl 1,2-dihydropteridine-6-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

methyl 7-bromo-5H-pyrrolo[2,3-b]pyrazine-2-carboxylate
CID 138111834
methyl 8,11,11-trimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-4-carboxylate
CID 59300643
methyl 4-methyl-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine-5-carboxylate
CID 82402887
methyl 6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine-2-carboxylate;hydrochloride
CID 170916820
3-methoxycarbonyl-6-methylpyrazine-2-carboxylic acid
CID 18668118
methyl 6-tert-butyl-5H-pyrrolo[2,3-b]pyrazine-3-carboxylate
CID 169233110
methyl 1,2-dihydro-1,6-naphthyridine-7-carboxylate
CID 141445688
methyl 2-(2,2-dimethylcyclopropyl)-1,3-thiazole-4-carboxylate
CID 107925304
methyl furo[2,3-b]pyrazine-2-carboxylate
CID 118656900
methyl 6-bromopyrazine-2-carboxylate
CID 52988070
methyl 2-iodo-1H-pyrrolo[2,3-c]pyridine-7-carboxylate
CID 174253439
methyl 3-amino-1,2,4-triazine-5-carboxylate
CID 105430024

Frequently Asked Questions

What is the IUPAC name of methyl 1,2-dihydropteridine-6-carboxylate?
The IUPAC name of methyl 1,2-dihydropteridine-6-carboxylate (CID 141110396) is methyl 1,2-dihydropteridine-6-carboxylate.
What is the SMILES notation for methyl 1,2-dihydropteridine-6-carboxylate?
The canonical SMILES for methyl 1,2-dihydropteridine-6-carboxylate is COC(=O)c1cnc2c(n1)C=NCN2.
What is the InChIKey of methyl 1,2-dihydropteridine-6-carboxylate?
The InChIKey is DFKHGJLZFBHUMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4O2/c1-14-8(13)6-3-10-7-5(12-6)2-9-4-11-7/h2-3H,4H2,1H3,(H,10,11).
What are the key properties of methyl 1,2-dihydropteridine-6-carboxylate?
methyl 1,2-dihydropteridine-6-carboxylate has a molecular weight of 192.18 g/mol, XLogP of 0.07, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1,2-dihydropteridine-6-carboxylate is sourced from PubChem (CID 141110396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).