methyl furo[2,3-b]pyrazine-2-carboxylate

C8H6N2O3 — CID 118656900

IUPACmethyl furo[2,3-b]pyrazine-2-carboxylate
SMILESCOC(=O)c1cnc2occc2n1
InChIInChI=1S/C8H6N2O3/c1-12-8(11)6-4-9-7-5(10-6)2-3-13-7/h2-4H,1H3
InChIKeyFCZRCGHDLQZMAH-UHFFFAOYSA-N
MW178.15 g/mol
LogP1.01
Rot. Bonds1

About methyl furo[2,3-b]pyrazine-2-carboxylate

methyl furo[2,3-b]pyrazine-2-carboxylate (PubChem CID 118656900) has the molecular formula C8H6N2O3 and a molecular weight of 178.15 g/mol. Its IUPAC name is methyl furo[2,3-b]pyrazine-2-carboxylate.

Molecular Properties

Compound Namemethyl furo[2,3-b]pyrazine-2-carboxylate
PubChem CID118656900
Molecular FormulaC8H6N2O3
Molecular Weight178.15 g/mol
Exact Mass178.04
IUPAC Namemethyl furo[2,3-b]pyrazine-2-carboxylate
SMILESCOC(=O)c1cnc2occc2n1
InChIInChI=1S/C8H6N2O3/c1-12-8(11)6-4-9-7-5(10-6)2-3-13-7/h2-4H,1H3
InChIKeyFCZRCGHDLQZMAH-UHFFFAOYSA-N
XLogP1.01
TPSA65.22 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500178.15
LogP ≤ 51.01
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl furo[2,3-b]pyrazine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl furo[2,3-b]pyrazine-2-carboxylate?
The IUPAC name of methyl furo[2,3-b]pyrazine-2-carboxylate (CID 118656900) is methyl furo[2,3-b]pyrazine-2-carboxylate.
What is the SMILES notation for methyl furo[2,3-b]pyrazine-2-carboxylate?
The canonical SMILES for methyl furo[2,3-b]pyrazine-2-carboxylate is COC(=O)c1cnc2occc2n1.
What is the InChIKey of methyl furo[2,3-b]pyrazine-2-carboxylate?
The InChIKey is FCZRCGHDLQZMAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O3/c1-12-8(11)6-4-9-7-5(10-6)2-3-13-7/h2-4H,1H3.
What are the key properties of methyl furo[2,3-b]pyrazine-2-carboxylate?
methyl furo[2,3-b]pyrazine-2-carboxylate has a molecular weight of 178.15 g/mol, XLogP of 1.01, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl furo[2,3-b]pyrazine-2-carboxylate is sourced from PubChem (CID 118656900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).