C27H30N2O4Si — CID 169233130
methyl 6-[1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]furo[2,3-b]pyrazine-2-carboxylate (PubChem CID 169233130) has the molecular formula C27H30N2O4Si and a molecular weight of 474.63 g/mol. Its IUPAC name is methyl 6-[1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]furo[2,3-b]pyrazine-2-carboxylate.
| Compound Name | methyl 6-[1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]furo[2,3-b]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 169233130 |
| Molecular Formula | C27H30N2O4Si |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | methyl 6-[1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]furo[2,3-b]pyrazine-2-carboxylate |
| SMILES | COC(=O)c1cnc2oc(C(C)CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)cc2n1 |
| InChI | InChI=1S/C27H30N2O4Si/c1-19(24-16-22-25(33-24)28-17-23(29-22)26(30)31-5)18-32-34(27(2,3)4,20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-17,19H,18H2,1-5H3 |
| InChIKey | PFSVJWQTWWQZHO-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|