C13H16ClN — CID 169233999
8-chloro-3,6-dimethylquinoline;ethane (PubChem CID 169233999) has the molecular formula C13H16ClN and a molecular weight of 221.73 g/mol. Its IUPAC name is 8-chloro-3,6-dimethylquinoline;ethane.
| Compound Name | 8-chloro-3,6-dimethylquinoline;ethane |
|---|---|
| PubChem CID | 169233999 |
| Molecular Formula | C13H16ClN |
| Molecular Weight | 221.73 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 8-chloro-3,6-dimethylquinoline;ethane |
| SMILES | CC.Cc1cnc2c(Cl)cc(C)cc2c1 |
| InChI | InChI=1S/C11H10ClN.C2H6/c1-7-3-9-4-8(2)6-13-11(9)10(12)5-7;1-2/h3-6H,1-2H3;1-2H3 |
| InChIKey | AAXUMPQMWJJKHK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.73 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |