C34H29Cl2F2N3O3 — CID 169234305
3-chloro-N-[2-[7-(5-chloro-2,4-difluorophenyl)-3-methyl-2,3,6,7-tetrahydrofuro[2,3-c]pyridin-5-yl]-2-phenylethyl]-8-methoxy-2-methylquinoline-6-carboxamide (PubChem CID 169234305) has the molecular formula C34H29Cl2F2N3O3 and a molecular weight of 636.53 g/mol. Its IUPAC name is 3-chloro-N-[2-[7-(5-chloro-2,4-difluorophenyl)-3-methyl-2,3,6,7-tetrahydrofuro[2,3-c]pyridin-5-yl]-2-phenylethyl]-8-methoxy-2-methylquinoline-6-carboxamide.
| Compound Name | 3-chloro-N-[2-[7-(5-chloro-2,4-difluorophenyl)-3-methyl-2,3,6,7-tetrahydrofuro[2,3-c]pyridin-5-yl]-2-phenylethyl]-8-methoxy-2-methylquinoline-6-carboxamide |
|---|---|
| PubChem CID | 169234305 |
| Molecular Formula | C34H29Cl2F2N3O3 |
| Molecular Weight | 636.53 g/mol |
| Exact Mass | 635.16 |
| IUPAC Name | 3-chloro-N-[2-[7-(5-chloro-2,4-difluorophenyl)-3-methyl-2,3,6,7-tetrahydrofuro[2,3-c]pyridin-5-yl]-2-phenylethyl]-8-methoxy-2-methylquinoline-6-carboxamide |
| SMILES | COc1cc(C(=O)NCC(C2=CC3=C(OCC3C)C(c3cc(Cl)c(F)cc3F)N2)c2ccccc2)cc2cc(Cl)c(C)nc12 |
| InChI | InChI=1S/C34H29Cl2F2N3O3/c1-17-16-44-33-22(17)13-29(41-32(33)23-12-26(36)28(38)14-27(23)37)24(19-7-5-4-6-8-19)15-39-34(42)21-9-20-10-25(35)18(2)40-31(20)30(11-21)43-3/h4-14,17,24,32,41H,15-16H2,1-3H3,(H,39,42) |
| InChIKey | XGEIGTQCRCRRDI-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.53 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|