C21H33NO3 — CID 169234463
[5-(5-hexyl-1H-pyrrol-2-yl)oxolan-2-yl]methyl 2-cyclobutylacetate (PubChem CID 169234463) has the molecular formula C21H33NO3 and a molecular weight of 347.50 g/mol. Its IUPAC name is [5-(5-hexyl-1H-pyrrol-2-yl)oxolan-2-yl]methyl 2-cyclobutylacetate.
| Compound Name | [5-(5-hexyl-1H-pyrrol-2-yl)oxolan-2-yl]methyl 2-cyclobutylacetate |
|---|---|
| PubChem CID | 169234463 |
| Molecular Formula | C21H33NO3 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.25 |
| IUPAC Name | [5-(5-hexyl-1H-pyrrol-2-yl)oxolan-2-yl]methyl 2-cyclobutylacetate |
| SMILES | CCCCCCc1ccc(C2CCC(COC(=O)CC3CCC3)O2)[nH]1 |
| InChI | InChI=1S/C21H33NO3/c1-2-3-4-5-9-17-10-12-19(22-17)20-13-11-18(25-20)15-24-21(23)14-16-7-6-8-16/h10,12,16,18,20,22H,2-9,11,13-15H2,1H3 |
| InChIKey | VAJGUVXLONJKCO-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|