C23H34N4O4 — CID 169234517
[5-[5-[N-(aminomethylidene)-N'-butanoylcarbamimidoyl]-1H-pyrrol-2-yl]oxolan-2-yl]methyl 2-cyclohexylacetate (PubChem CID 169234517) has the molecular formula C23H34N4O4 and a molecular weight of 430.55 g/mol. Its IUPAC name is [5-[5-[N-(aminomethylidene)-N'-butanoylcarbamimidoyl]-1H-pyrrol-2-yl]oxolan-2-yl]methyl 2-cyclohexylacetate.
| Compound Name | [5-[5-[N-(aminomethylidene)-N'-butanoylcarbamimidoyl]-1H-pyrrol-2-yl]oxolan-2-yl]methyl 2-cyclohexylacetate |
|---|---|
| PubChem CID | 169234517 |
| Molecular Formula | C23H34N4O4 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | [5-[5-[N-(aminomethylidene)-N'-butanoylcarbamimidoyl]-1H-pyrrol-2-yl]oxolan-2-yl]methyl 2-cyclohexylacetate |
| SMILES | CCCC(=O)/N=C(\N=C\N)c1ccc(C2CCC(COC(=O)CC3CCCCC3)O2)[nH]1 |
| InChI | InChI=1S/C23H34N4O4/c1-2-6-21(28)27-23(25-15-24)19-11-10-18(26-19)20-12-9-17(31-20)14-30-22(29)13-16-7-4-3-5-8-16/h10-11,15-17,20,26H,2-9,12-14H2,1H3,(H2,24,25,27,28) |
| InChIKey | ZSFXQORNFDTMPC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 119.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|