C14H18BrF2N — CID 169239119
3-[(4-bromophenyl)methyl]-1-(3,3-difluoropropyl)pyrrolidine (PubChem CID 169239119) has the molecular formula C14H18BrF2N and a molecular weight of 318.20 g/mol. Its IUPAC name is 3-[(4-bromophenyl)methyl]-1-(3,3-difluoropropyl)pyrrolidine.
| Compound Name | 3-[(4-bromophenyl)methyl]-1-(3,3-difluoropropyl)pyrrolidine |
|---|---|
| PubChem CID | 169239119 |
| Molecular Formula | C14H18BrF2N |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 3-[(4-bromophenyl)methyl]-1-(3,3-difluoropropyl)pyrrolidine |
| SMILES | FC(F)CCN1CCC(Cc2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C14H18BrF2N/c15-13-3-1-11(2-4-13)9-12-5-7-18(10-12)8-6-14(16)17/h1-4,12,14H,5-10H2 |
| InChIKey | KFMDWTDEXKTFRF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |