C21H21F2N2O+ — CID 169239894
[1-[2-[2-(2,6-difluorophenyl)-4-methylphenyl]cyclopropanecarbonyl]pyrrolidin-3-ylidene]azanium (PubChem CID 169239894) has the molecular formula C21H21F2N2O+ and a molecular weight of 355.41 g/mol. Its IUPAC name is [1-[2-[2-(2,6-difluorophenyl)-4-methylphenyl]cyclopropanecarbonyl]pyrrolidin-3-ylidene]azanium.
| Compound Name | [1-[2-[2-(2,6-difluorophenyl)-4-methylphenyl]cyclopropanecarbonyl]pyrrolidin-3-ylidene]azanium |
|---|---|
| PubChem CID | 169239894 |
| Molecular Formula | C21H21F2N2O+ |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | [1-[2-[2-(2,6-difluorophenyl)-4-methylphenyl]cyclopropanecarbonyl]pyrrolidin-3-ylidene]azanium |
| SMILES | Cc1ccc(C2CC2C(=O)N2CCC(=[NH2+])C2)c(-c2c(F)cccc2F)c1 |
| InChI | InChI=1S/C21H20F2N2O/c1-12-5-6-14(16(9-12)20-18(22)3-2-4-19(20)23)15-10-17(15)21(26)25-8-7-13(24)11-25/h2-6,9,15,17,24H,7-8,10-11H2,1H3/p+1 |
| InChIKey | HWEHWUZRDQXKPP-UHFFFAOYSA-O |
| XLogP | 2.48 |
| TPSA | 45.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|