C23H24F2N2O2S — CID 174141655
[(1R,2R)-2-[2-(2,6-difluorophenyl)phenyl]cyclopropyl]-[4-hydroxy-3-(methylsulfanyliminomethyl)piperidin-1-yl]methanone (PubChem CID 174141655) has the molecular formula C23H24F2N2O2S and a molecular weight of 430.52 g/mol. Its IUPAC name is [(1R,2R)-2-[2-(2,6-difluorophenyl)phenyl]cyclopropyl]-[4-hydroxy-3-(methylsulfanyliminomethyl)piperidin-1-yl]methanone.
| Compound Name | [(1R,2R)-2-[2-(2,6-difluorophenyl)phenyl]cyclopropyl]-[4-hydroxy-3-(methylsulfanyliminomethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 174141655 |
| Molecular Formula | C23H24F2N2O2S |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | [(1R,2R)-2-[2-(2,6-difluorophenyl)phenyl]cyclopropyl]-[4-hydroxy-3-(methylsulfanyliminomethyl)piperidin-1-yl]methanone |
| SMILES | CSN=CC1CN(C(=O)[C@@H]2C[C@H]2c2ccccc2-c2c(F)cccc2F)CCC1O |
| InChI | InChI=1S/C23H24F2N2O2S/c1-30-26-12-14-13-27(10-9-21(14)28)23(29)18-11-17(18)15-5-2-3-6-16(15)22-19(24)7-4-8-20(22)25/h2-8,12,14,17-18,21,28H,9-11,13H2,1H3/t14?,17-,18+,21?/m0/s1 |
| InChIKey | CJYQXQYUTOZALR-ILYDOWTOSA-N |
| XLogP | 4.29 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|