C24H27F2N3O2S — CID 169240216
[2-[(azetidin-1-ylsulfanylamino)methyl]morpholin-4-yl]-[(1R,2R)-2-[2-(2,6-difluorophenyl)phenyl]cyclopropyl]methanone (PubChem CID 169240216) has the molecular formula C24H27F2N3O2S and a molecular weight of 459.56 g/mol. Its IUPAC name is [2-[(azetidin-1-ylsulfanylamino)methyl]morpholin-4-yl]-[(1R,2R)-2-[2-(2,6-difluorophenyl)phenyl]cyclopropyl]methanone.
| Compound Name | [2-[(azetidin-1-ylsulfanylamino)methyl]morpholin-4-yl]-[(1R,2R)-2-[2-(2,6-difluorophenyl)phenyl]cyclopropyl]methanone |
|---|---|
| PubChem CID | 169240216 |
| Molecular Formula | C24H27F2N3O2S |
| Molecular Weight | 459.56 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | [2-[(azetidin-1-ylsulfanylamino)methyl]morpholin-4-yl]-[(1R,2R)-2-[2-(2,6-difluorophenyl)phenyl]cyclopropyl]methanone |
| SMILES | O=C([C@@H]1C[C@H]1c1ccccc1-c1c(F)cccc1F)N1CCOC(CNSN2CCC2)C1 |
| InChI | InChI=1S/C24H27F2N3O2S/c25-21-7-3-8-22(26)23(21)18-6-2-1-5-17(18)19-13-20(19)24(30)28-11-12-31-16(15-28)14-27-32-29-9-4-10-29/h1-3,5-8,16,19-20,27H,4,9-15H2/t16?,19-,20+/m0/s1 |
| InChIKey | OVYOSYKEJIQBKC-KHMGXFTDSA-N |
| XLogP | 3.82 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.56 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|