C24H26F2N2OS — CID 174141636
[2-[2-(2,6-difluorophenyl)phenyl]cyclopropyl]-[3-(ethylsulfanyliminomethyl)piperidin-1-yl]methanone (PubChem CID 174141636) has the molecular formula C24H26F2N2OS and a molecular weight of 428.55 g/mol. Its IUPAC name is [2-[2-(2,6-difluorophenyl)phenyl]cyclopropyl]-[3-(ethylsulfanyliminomethyl)piperidin-1-yl]methanone.
| Compound Name | [2-[2-(2,6-difluorophenyl)phenyl]cyclopropyl]-[3-(ethylsulfanyliminomethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 174141636 |
| Molecular Formula | C24H26F2N2OS |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | [2-[2-(2,6-difluorophenyl)phenyl]cyclopropyl]-[3-(ethylsulfanyliminomethyl)piperidin-1-yl]methanone |
| SMILES | CCSN=CC1CCCN(C(=O)C2CC2c2ccccc2-c2c(F)cccc2F)C1 |
| InChI | InChI=1S/C24H26F2N2OS/c1-2-30-27-14-16-7-6-12-28(15-16)24(29)20-13-19(20)17-8-3-4-9-18(17)23-21(25)10-5-11-22(23)26/h3-5,8-11,14,16,19-20H,2,6-7,12-13,15H2,1H3 |
| InChIKey | IPZWDXNDNIYVEL-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|