C22H24F2N2OS — CID 169240140
[2-[2-(3,5-difluorophenyl)phenyl]cyclopropyl]-[3-(methylsulfanylamino)piperidin-1-yl]methanone (PubChem CID 169240140) has the molecular formula C22H24F2N2OS and a molecular weight of 402.51 g/mol. Its IUPAC name is [2-[2-(3,5-difluorophenyl)phenyl]cyclopropyl]-[3-(methylsulfanylamino)piperidin-1-yl]methanone.
| Compound Name | [2-[2-(3,5-difluorophenyl)phenyl]cyclopropyl]-[3-(methylsulfanylamino)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 169240140 |
| Molecular Formula | C22H24F2N2OS |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | [2-[2-(3,5-difluorophenyl)phenyl]cyclopropyl]-[3-(methylsulfanylamino)piperidin-1-yl]methanone |
| SMILES | CSNC1CCCN(C(=O)C2CC2c2ccccc2-c2cc(F)cc(F)c2)C1 |
| InChI | InChI=1S/C22H24F2N2OS/c1-28-25-17-5-4-8-26(13-17)22(27)21-12-20(21)19-7-3-2-6-18(19)14-9-15(23)11-16(24)10-14/h2-3,6-7,9-11,17,20-21,25H,4-5,8,12-13H2,1H3 |
| InChIKey | ALVSRGVITDEESM-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|